Online Database of Chemicals from Around the World
| Pribolab Pte. Ltd. | Singapore | Inquire | ||
|---|---|---|---|---|
 |
+86 4006885349 | |||
 |
sales@pribolab.com | |||
| Chemical manufacturer since 2008 | ||||
| chemBlink standard supplier since 2021 | ||||
| Name | Aflatoxin B2 alpha |
|---|---|
| Synonyms | 11-Methoxy-6,8,19-trioxapentacyclo[10.7.0.02,9.03,7.013,17]nonadeca-1,9,11,13(17)-tetraene-16,18-dione |
| Molecular Structure | ![CAS # 22040-96-6, Aflatoxin B2 alpha, 11-Methoxy-6,8,19-trioxapentacyclo[10.7.0.02,9.03,7.013,17]nonadeca-1,9,11,13(17)-tetraene-16,18-dione](/structures/22040-96-6.gif) |
| Molecular Formula | C17H14O6 |
| Molecular Weight | 314.29 |
| CAS Registry Number | 22040-96-6 |
| SMILES | COC1=C2C3=C(C(=O)CC3)C(=O)OC2=C4C5CCOC5OC4=C1 |
| Solubility | 585.4 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.660, Calc.* |
| Melting point | 199.75 ºC |
| Boiling Point | 472.50 ºC, 521.0±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 234.0±30.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Aflatoxin B2 alpha |