| Nanjing Sinfoo Technology Co., | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 15380750425 | |||
![]() |
sales@sinfoobiotech.com | |||
| Chemical distributor since 2017 | ||||
| chemBlink standard supplier since 2020 | ||||
| Name | Phenazine-1,6-dicarboxylic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C14H8N2O4 |
| Molecular Weight | 268.22 |
| CAS Registry Number | 23462-25-1 |
| SMILES | C1=CC(=C2C(=C1)N=C3C(=N2)C=CC=C3C(=O)O)C(=O)O |
| Solubility | 52 mg/L (25 ºC water) |
|---|---|
| Density | 1.6±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.795, Calc.* |
| Melting point | 214.48 ºC |
| Boiling Point | 504.04 ºC, 628.4±25.0 ºC (760 mmHg), Calc.* |
| Flash Point | 333.9±23.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P261-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Phenazine-1,6-dicarboxylic acid |