| Guangzhou Topwork Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (20) 8731-7062 +86 13544492387 | |||
![]() |
sales@topworkchem.com topwork2004@hotmail.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 13544492387 | |||
![]() |
WhatsApp: 13544492387 | |||
| Chemical manufacturer since 2004 | ||||
| chemBlink standard supplier since 2006 | ||||
| Classification | API >> Anesthetic agents >> General anesthetics |
|---|---|
| Name | Alfaxalone |
| Synonyms | (3R,5S,8S,9S,10S,13S,14S,17S)-17-acetyl-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-one |
| Molecular Structure | ![]() |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 |
| CAS Registry Number | 23930-19-0 |
| EC Number | 636-625-6 |
| SMILES | CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC(=O)[C@H]3[C@H]2CC[C@@H]4[C@@]3(CC[C@H](C4)O)C)C |
| Solubility | 40.38 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.533, Calc.* |
| Melting point | 172.74 ºC |
| Boiling Point | 428.64 ºC, 468.1±40.0 ºC (760 mmHg), Calc.* |
| Flash Point | 251.0±23.8 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H301 Details | ||||||||||||
| Precautionary Statements | P264-P270-P301+P310+P330-P405-P501 Details | ||||||||||||
| Hazard Classification | |||||||||||||
| |||||||||||||
| SDS | Available | ||||||||||||
| Market Analysis Reports |
| List of Reports Available for Alfaxalone |