| NANJING TOMMLAB PHARMATECH Co., LTD | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (025) 8616-1360 | |||
![]() |
tommlab@163.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink standard supplier since 2020 | ||||
| Name | N-(3-Acetamidophenyl)-2-methylpropanamide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 |
| CAS Registry Number | 25227-75-2 |
| SMILES | CC(C)C(=O)Nc1cccc(c1)NC(=O)C |
| Solubility | 3829 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.593, Calc.* |
| Melting point | 185.32 ºC |
| Boiling Point | 441.59 ºC, 472.2±28.0 ºC (760 mmHg), Calc.* |
| Flash Point | 198.5±24.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for N-(3-Acetamidophenyl)-2-methylpropanamide |