Online Database of Chemicals from Around the World
| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (551) 6288-8437 +86 18096409024 | |||
 |
info@purerechem.com | |||
 |
Skype Chat | |||
 |
QQ chat | |||
 |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | 3-Acetamidophthalimide |
|---|---|
| Synonyms | N-(1,3-dioxoisoindol-4-yl)acetamide |
| Molecular Structure |  |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.18 |
| CAS Registry Number | 6118-65-6 |
| SMILES | CC(=O)NC1=CC=CC2=C1C(=O)NC2=O |
| Solubility | 2788 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.656, Calc.* |
| Melting point | 233.11 ºC |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 3-Acetamidophthalimide |