| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | n5-(2-Hydroxyethyl)-l-glutamine |
|---|---|
| Synonyms | (2S)-2-amino-5-(2-hydroxyethylamino)-5-oxopentanoic acid |
| Molecular Structure | ![]() |
| Protein Sequence | XG |
| Molecular Formula | C7H14N2O4 |
| Molecular Weight | 190.20 |
| CAS Registry Number | 2650-74-0 |
| SMILES | C(CC(=O)NCCO)[C@@H](C(=O)O)N |
| Solubility | 5.357e+004 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.523, Calc.* |
| Melting point | 299.86 ºC |
| Boiling Point | 518.8±50.0 ºC (760 mmHg), Calc.*, 451.40 ºC |
| Flash Point | 267.6±30.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for n5-(2-Hydroxyethyl)-l-glutamine |