| Bakul APIs | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (22) 6169-7900 | |||
![]() |
sales@bakulpharma.com | |||
| Chemical manufacturer since 1997 | ||||
| chemBlink standard supplier since 2022 | ||||
| Name | N-(2-Hydroxyethyl)-N-(2-hydroxypropyl)-p-toluenesulphonamide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H19NO4S |
| Molecular Weight | 273.35 |
| CAS Registry Number | 26831-90-3 |
| EC Number | 248-021-6 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N(CCO)CC(C)O |
| Solubility | 6922 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.564, Calc.* |
| Melting point | 163.93 ºC |
| Boiling Point | 425.76 ºC, 454.4±55.0 ºC (760 mmHg), Calc.* |
| Flash Point | 228.6±31.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-(2-Hydroxyethyl)-N-(2-hydroxypropyl)-p-toluenesulphonamide |