| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | 4-(3-Butoxy-4-methoxybenzyl)-2-imidazolidinone |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 |
| CAS Registry Number | 29925-17-5 |
| EC Number | 636-902-1 |
| SMILES | CCCCOC1=C(C=CC(=C1)CC2CNC(=O)N2)OC |
| Solubility | 118.2 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.521, Calc.* |
| Melting point | 172.67 ºC |
| Boiling Point | 422.26 ºC, 483.8±25.0 ºC (760 mmHg), Calc.* |
| Flash Point | 246.4±23.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H315-H319-H335 Details | ||||||||||||||||||||
| Precautionary Statements | P261-P264-P264+P265-P271-P280-P302+P352-P304+P340-P305+P351+P338-P319-P321-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||
| |||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 4-(3-Butoxy-4-methoxybenzyl)-2-imidazolidinone |