Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | API >> Inhibitor drug |
|---|---|
| Name | CAY10499 |
| Synonyms | Magl-IN-5;benzyl N-[4-(5-methoxy-2-oxo-1,3,4-oxadiazol-3-yl)-2-methylphenyl]carbamate |
| Molecular Structure | ![CAS # 359714-55-9, CAY10499, Magl-IN-5,benzyl N-[4-(5-methoxy-2-oxo-1,3,4-oxadiazol-3-yl)-2-methylphenyl]carbamate](/structures/359714-55-9.gif) |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.34 |
| CAS Registry Number | 359714-55-9 |
| SMILES | CC1=C(C=CC(=C1)N2C(=O)OC(=N2)OC)NC(=O)OCC3=CC=CC=C3 |
| Solubility | 129.7 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.610, Calc.* |
| Melting point | 217.12 ºC |
| Boiling Point | 509.68 ºC |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for CAY10499 |