| Shanghai Worldyang Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13651600618 +86 (21) 5679-5779 | |||
![]() |
sales7777@worldyachem.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 13651600618 | |||
![]() |
WhatsApp: +86 13651600618 | |||
| Chemical manufacturer since 2012 | ||||
| chemBlink premium supplier since 2023 | ||||
| Name | Oxilofrine |
|---|---|
| Synonyms | 4-[(1S,2R)-1-hydroxy-2-(methylamino)propyl]phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 |
| CAS Registry Number | 365-26-4 (33987-39-2;34597-44-9) |
| EC Number | 206-672-3 |
| SMILES | C[C@H]([C@H](C1=CC=C(C=C1)O)O)NC |
| Solubility | 1 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.559, Calc.* |
| Melting point | 89.17 ºC |
| Boiling Point | 312.12 ºC, 343.8±27.0 ºC (760 mmHg), Calc.* |
| Flash Point | 149.9±14.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Oxilofrine |