| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Flucofuron |
|---|---|
| Synonyms | 1,3-bis[4-chloro-3-(trifluoromethyl)phenyl]urea |
| Molecular Structure | ![]() |
| Molecular Formula | C15H8Cl2F6N2O |
| Molecular Weight | 417.13 |
| CAS Registry Number | 370-50-3 |
| EC Number | 206-728-7 |
| SMILES | C1=CC(=C(C=C1NC(=O)NC2=CC(=C(C=C2)Cl)C(F)(F)F)C(F)(F)F)Cl |
| Solubility | 0.01256 mg/L (25 ºC water) |
|---|---|
| Density | 1.6±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.564, Calc.* |
| Melting point | 176.49 ºC |
| Boiling Point | 422.70 ºC, 339.9±42.0 ºC (760 mmHg), Calc.* |
| Flash Point | 159.4±27.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302 Details | ||||||||||||
| Precautionary Statements | P264-P270-P301+P317-P330-P501 Details | ||||||||||||
| Hazard Classification | |||||||||||||
| |||||||||||||
| SDS | Available | ||||||||||||
| Market Analysis Reports |
| List of Reports Available for Flucofuron |