| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Fludarabine Phosphate EP Impurity G |
|---|---|
| Synonyms | 9-(2-Chloro-2-deoxy-5-O-phosphono-beta-D-arabinofuranosyl)-2-fluoro-9H-purin-6-amine |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12ClFN5O6P |
| Molecular Weight | 383.66 |
| CAS Registry Number | 548774-56-7 |
| SMILES | C1=NC2=C(N=C(N=C2N1[C@H]3[C@H]([C@@H]([C@H](O3)COP(=O)(O)O)O)Cl)F)N |
| Density | 2.3±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.850, Calc.* |
| Boiling Point | 863.0±75.0 ºC (760 mmHg), Calc.* |
| Flash Point | 475.7±37.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Fludarabine Phosphate EP Impurity G |