Copper(I) trifluoromethanesulfonate benzene complex
[CAS# 37234-97-2]

Identification

• Classification: Chemical reagent >> Organic reagent >> Sulfonate / sulfinate
• Name: Copper(I) trifluoromethanesulfonate benzene complex
• Molecular Formula: C₈H₆Cu₂F₆O₆S₂
• Molecular Weight: 503.33
• CAS Registry Number: 37234-97-2
• EC Number: 680-450-8
• SMILES: C(F)(F)(F)S(=O)(=O)[O-].[Cu+]

Properties

• Solubility: Soluble (hot benzene)

Safety Data

• Hazard Symbols: GHS02;GHS08 Danger
• Hazard Statements: H228-H372
• Precautionary Statements: P210-P240-P241-P260-P264-P270-P280-P319-P370+P378-P501

Discovory and Applicatios

Copper(I) trifluoromethanesulfonate benzene complex is an intriguing coordination compound that has garnered attention for its unique properties and applications in various chemical processes. This complex consists of a copper(I) ion coordinated with trifluoromethanesulfonate ligands and associated with benzene as a solvent or additional ligand. Its distinctive structure and reactivity have made it a subject of interest in coordination chemistry and catalysis.

The discovery of the copper(I) trifluoromethanesulfonate benzene complex arose from the broader investigation of copper(I) complexes and their applications. Copper(I) salts, known for their ability to participate in various chemical reactions, are often explored for their catalytic properties. The introduction of trifluoromethanesulfonate (triflate) as a ligand enhances the stability and reactivity of copper(I) complexes. The addition of benzene as a ligand or solvent further influences the properties of the complex, providing additional avenues for its use in chemical transformations.

The synthesis of the copper(I) trifluoromethanesulfonate benzene complex typically involves the reaction of copper(I) salts with trifluoromethanesulfonic acid or its derivatives in the presence of benzene. This process requires precise control over conditions such as temperature and concentration to achieve the desired product. The reaction is usually carried out under an inert atmosphere to prevent oxidation of the copper(I) species. After synthesis, the complex is purified through methods such as recrystallization or chromatography. Characterization is performed using techniques like infrared (IR) spectroscopy, nuclear magnetic resonance (NMR) spectroscopy, and X-ray crystallography to confirm the structure and purity of the complex.

One of the primary applications of the copper(I) trifluoromethanesulfonate benzene complex is in catalysis. The complex serves as a catalyst or catalyst precursor in a variety of organic transformations. Its ability to facilitate reactions such as oxidation, reduction, and cross-coupling makes it valuable in synthetic chemistry. For example, the complex can be used in coupling reactions, where it promotes the formation of carbon-carbon bonds. The triflate ligand stabilizes the copper center, enhancing the efficiency and selectivity of these catalytic processes.

In addition to its role in catalysis, the copper(I) trifluoromethanesulfonate benzene complex finds applications in materials science. The complex's unique properties allow it to be used in the synthesis of novel materials with specific electronic or optical characteristics. For instance, it can be employed to prepare copper-based materials or thin films that exhibit desirable properties such as conductivity or luminescence. The benzene component in the complex contributes to its solubility and stability, facilitating its use in these advanced materials.

Another significant application of the copper(I) trifluoromethanesulfonate benzene complex is in the field of organic electronics. The complex's ability to form stable complexes with organic semiconductors or polymers makes it suitable for use in organic light-emitting diodes (OLEDs) and other electronic devices. Its role in enhancing the performance and stability of these devices highlights its importance in the development of advanced electronic technologies.

Despite its advantages, challenges associated with the copper(I) trifluoromethanesulfonate benzene complex include optimizing its synthesis and exploring its full range of applications. Ongoing research aims to address these challenges by developing more efficient synthetic methods and discovering new uses for the complex.

Future research into the copper(I) trifluoromethanesulfonate benzene complex may focus on expanding its applications in emerging fields such as sustainable chemistry and green technologies. Its unique properties offer opportunities for innovation in both catalysis and materials science, contributing to advancements in these areas.