| R&D Scientific Inc. | Canada | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (226) 600-0236 | |||
![]() |
sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | Cyclopentane-1,2,3,4-tetracarboxylic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H10O8 |
| Molecular Weight | 246.17 |
| CAS Registry Number | 3786-91-2 |
| EC Number | 223-256-7 |
| SMILES | C1C(C(C(C1C(=O)O)C(=O)O)C(=O)O)C(=O)O |
| Solubility | 6.263e+005 mg/L (25 ºC water) |
|---|---|
| Density | 1.8±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.606, Calc.* |
| Melting point | 205.18 ºC |
| Boiling Point | 484.13 ºC, 495.6±45.0 ºC (760 mmHg), Calc.* |
| Flash Point | 267.6±25.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H301-H311-H314-H331 Details | ||||||||||||||||||||||||
| Precautionary Statements | P260-P261-P264-P270-P271-P280-P301+P316-P301+P330+P331-P302+P352-P302+P361+P354-P304+P340-P305+P354+P338-P316-P321-P330-P361+P364-P363-P403+P233-P405-P501 Details | ||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||
| |||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for Cyclopentane-1,2,3,4-tetracarboxylic acid |