| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,5,7,8-Tetramethyl-2-(4,8,12-trimethyltridecyl)-2H-1-benzopyran-6-ol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C29H48O2 |
| Molecular Weight | 428.69 |
| CAS Registry Number | 3808-26-2 |
| SMILES | CC1=C(C2=C(C=CC(O2)(C)CCCC(C)CCCC(C)CCCC(C)C)C(=C1O)C)C |
| Solubility | 4.679e-007 mg/L (25 ºC water) |
|---|---|
| Density | 0.9±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.502, Calc.* |
| Melting point | 203.44 ºC |
| Boiling Point | 480.39 ºC, 529.1±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 211.1±24.4 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P261-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 2,5,7,8-Tetramethyl-2-(4,8,12-trimethyltridecyl)-2H-1-benzopyran-6-ol |