| R&D Scientific Inc. | Canada | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (226) 600-0236 | |||
![]() |
sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | Ambroxdiol |
|---|---|
| Synonyms | (1R,2R,4aS,8aS)-1-(2-hydroxyethyl)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 |
| CAS Registry Number | 38419-75-9 |
| SMILES | C[C@]12CCCC([C@@H]1CC[C@@]([C@@H]2CCO)(C)O)(C)C |
| Solubility | 4.883 mg/L (25 ºC water) |
|---|---|
| Density | 1.0±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.485, Calc.* |
| Melting point | 115.89 ºC |
| Boiling Point | 345.48 ºC, 315.3±10.0 ºC (760 mmHg), Calc.* |
| Flash Point | 132.8±13.6 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Ambroxdiol |