| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)pyridine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H9N5 |
| Molecular Weight | 223.23 |
| CAS Registry Number | 4329-78-6 |
| SMILES | C1=CN=CC=C1C2=NC(=NN2)C3=CC=NC=C3 |
| Solubility | 1.538e+004 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.647, Calc.* |
| Melting point | 184.39 ºC |
| Boiling Point | 439.61 ºC, 525.0±60.0 ºC (760 mmHg), Calc.* |
| Flash Point | 255.8±25.8 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P261-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 4-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)pyridine |