| Hoffman Fine Chemicals Pty Ltd | Australia | Inquire | ||
|---|---|---|---|---|
![]() |
+61 3-7003-5401 | |||
![]() |
info@hoffmanchemicals.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2023 | ||||
| Classification | Organic raw materials >> Aryl compounds >> Anilines |
|---|---|
| Name | 2-(Pyridin-3-yl)-4-(trifluoromethyl)aniline |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9F3N2 |
| Molecular Weight | 238.21 |
| CAS Registry Number | 923293-15-6 |
| SMILES | C1=CC(=CN=C1)C2=C(C=CC(=C2)C(F)(F)F)N |
| Density | 1.3±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.546, Calc.* |
| Boiling Point | 334.9±42.0 ºC (760 mmHg), Calc.* |
| Flash Point | 156.3±27.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 2-(Pyridin-3-yl)-4-(trifluoromethyl)aniline |