Shenzhen Nexconn Pharmatechs Ltd. | China | Inquire | ||
---|---|---|---|---|
![]() |
+86 19068605196 | |||
![]() |
jason.deng@nexconn.com | |||
Chemical manufacturer since 2009 | ||||
chemBlink standard supplier since 2025 | ||||
Classification | Chemical reagent >> Organic reagent >> Amine salt (ammonium salt) |
---|---|
Name | N,N,N-Triethyl-3-((4-methylthiophen-3-yl)oxy)propan-1-aminium bromide |
Molecular Structure | ![]() |
Molecular Formula | C14H26BrNOS |
Molecular Weight | 336.33 |
CAS Registry Number | 471269-03-1 |
SMILES | C1(=CSC=C1OCCC[N+](CC)(CC)CC)C.[Br-] |
N,N,N-Triethyl-3-((4-methylthiophen-3-yl)oxy)propan-1-aminium bromide is a quaternary ammonium compound that has been studied primarily for its potential applications in the fields of materials science and organic electronics. The chemical is characterized by a positively charged nitrogen atom and an alkyl group, which gives it distinct properties suitable for use in various chemical and industrial applications. The discovery of this compound can be traced to research on quaternary ammonium salts, which have been of interest for many years due to their unique ionic properties. These compounds, including N,N,N-Triethyl-3-((4-methylthiophen-3-yl)oxy)propan-1-aminium bromide, are often synthesized through the alkylation of tertiary amines with alkyl halides. In the case of this particular compound, the 4-methylthiophen-3-yl group is incorporated into the structure, introducing both an aromatic ring and sulfur into the molecular framework, which may impart specific electronic and chemical properties. Applications of N,N,N-Triethyl-3-((4-methylthiophen-3-yl)oxy)propan-1-aminium bromide have been explored mainly in the context of organic materials and devices. One notable application is its use in organic light-emitting diodes (OLEDs) and organic photovoltaic cells (OPVs), where it can be utilized as a hole-transport material (HTM). In these devices, quaternary ammonium compounds are valued for their ability to facilitate efficient charge transport, particularly hole transport, within the organic semiconductor layers. In addition to its role in organic electronics, the compound has also been studied for its potential use in ionic liquids and as a surfactant in various chemical processes. Ionic liquids, which are salts in liquid form at or near room temperature, have garnered interest for their potential applications in catalysis, energy storage, and electrochemistry. N,N,N-Triethyl-3-((4-methylthiophen-3-yl)oxy)propan-1-aminium bromide, with its unique chemical structure, could be of interest in these areas due to its ionic properties and solubility characteristics. As with many quaternary ammonium salts, the compound’s biocompatibility and toxicity have been subjects of investigation, especially as it relates to environmental concerns. Its potential toxicity, particularly in aquatic environments, may limit its use in certain applications, necessitating further studies on safe handling and disposal. In summary, N,N,N-Triethyl-3-((4-methylthiophen-3-yl)oxy)propan-1-aminium bromide is a compound of significant interest in organic electronics and materials science. Its discovery and subsequent applications in the development of electronic devices, such as OLEDs and OPVs, highlight its utility, although its environmental impact remains an area for further research. |
Market Analysis Reports |
List of Reports Available for N,N,N-Triethyl-3-((4-methylthiophen-3-yl)oxy)propan-1-aminium bromide |