| Henan Ouber Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (371) 6532-2607 +86 18937141980 | |||
![]() |
anna.zhang@oubertec.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18937141980 | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink massive supplier since 2020 | ||||
| Name | LPK-26 hydrochloride |
|---|---|
| Synonyms | 2-(3,4-dichlorophenyl)-N-[(2S)-1-(2,5-dihydropyrrol-1-yl)-3-methylbutan-2-yl]-N-methylacetamide;hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C18H25Cl3N2O |
| Molecular Weight | 391.76 |
| CAS Registry Number | 492451-07-7 |
| EC Number | 633-358-7 |
| SMILES | CC(C)[C@@H](CN1CC=CC1)N(C)C(=O)CC2=CC(=C(C=C2)Cl)Cl.Cl |
| Solubility | 1.519 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.559, Calc.* |
| Melting point | 169.36 ºC |
| Boiling Point | 478.0±45.0 ºC (760 mmHg), Calc.*, 427.42 ºC |
| Flash Point | 242.9±28.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H315-H319-H335 Details | ||||||||||||||||||||
| Precautionary Statements | P261-P264-P264+P265-P271-P280-P302+P352-P304+P340-P305+P351+P338-P319-P321-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||
| |||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for LPK-26 hydrochloride |