Sinocure Chemical Group | China | Inquire | ||
---|---|---|---|---|
![]() |
+86 15550440621 | |||
![]() |
info@sinocurechem.com | |||
Chemical manufacturer since 2020 | ||||
Classification | Organic raw materials >> Carboxylic compounds and derivatives >> Carboxylic esters and their derivatives |
---|---|
Name | 2-[2-[2-[2-(4-nonylphenoxy)ethoxy]ethoxy]ethoxy]ethyl Prop-2-enoate |
Molecular Structure | ![]() |
Molecular Formula | C26H42O6 |
Molecular Weight | 450.61 |
CAS Registry Number | 50974-47-5 |
EC Number | 610-592-8 |
SMILES | CCCCCCCCCC1=CC=C(C=C1)OCCOCCOCCOCCOC(=O)C=C |
Hazard Symbols |
| ||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Hazard Statements | H315-H319-H335 Details | ||||||||||||||||||||||||
Precautionary Statements | P261-P264-P264+P265-P271-P280-P302+P352-P304+P340-P305+P351+P338-P319-P321-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||||||||||
Hazard Classification | |||||||||||||||||||||||||
| |||||||||||||||||||||||||
2-[2-[2-[2-(4-nonylphenoxy)ethoxy]ethoxy]ethoxy]ethyl Prop-2-enoate, a complex organic compound, represents an advanced class of chemicals used in various industrial applications. Its structure includes multiple ethoxy and phenoxy groups attached to a central prop-2-enoate moiety, which gives it distinctive properties and functional advantages. The discovery of this compound stems from ongoing research into advanced polymer materials and surfactants. The synthesis of 2-[2-[2-[2-(4-nonylphenoxy)ethoxy]ethoxy]ethoxy]ethyl Prop-2-enoate involves sophisticated chemical processes designed to introduce multiple ethoxy and phenoxy groups into a single molecule. This structural complexity contributes to its unique physical and chemical properties, including enhanced solubility and reactivity. One of the primary applications of 2-[2-[2-[2-(4-nonylphenoxy)ethoxy]ethoxy]ethoxy]ethyl Prop-2-enoate is in the field of polymer chemistry. It is utilized as a monomer in the synthesis of advanced polymers and copolymers. The compound's ability to form stable and versatile polymer chains makes it valuable in creating materials with tailored properties, such as improved durability, flexibility, and resistance to environmental factors. These properties are essential for applications in industries like automotive, aerospace, and consumer goods, where high-performance materials are required. Additionally, 2-[2-[2-[2-(4-nonylphenoxy)ethoxy]ethoxy]ethoxy]ethyl Prop-2-enoate is employed in the formulation of specialty surfactants. Its structure allows it to function effectively as a surfactant in various cleaning and emulsifying applications. The compound's surfactant properties make it useful in industrial cleaning agents, detergents, and personal care products, where it helps to reduce surface tension and improve the effectiveness of cleaning processes. In the coatings industry, this compound is used as an additive in the formulation of coatings and paints. Its inclusion in these products enhances their adhesion, durability, and resistance to weathering. The compound's ability to interact with different surfaces and provide a protective layer contributes to the longevity and performance of coatings applied to various substrates, including metals, plastics, and textiles. The compound also finds use in the field of adhesives and sealants. Its chemical structure allows it to form strong bonds and contribute to the overall performance of adhesive formulations. This application is crucial in industries where reliable bonding and sealing are required, such as in the assembly of electronic components, automotive parts, and construction materials. Overall, 2-[2-[2-[2-(4-nonylphenoxy)ethoxy]ethoxy]ethoxy]ethyl Prop-2-enoate is a versatile chemical compound with significant applications across various industrial sectors. Its unique structure and properties make it an important component in the development of advanced polymers, surfactants, coatings, and adhesives. |
Market Analysis Reports |
List of Reports Available for 2-[2-[2-[2-(4-nonylphenoxy)ethoxy]ethoxy]ethoxy]ethyl Prop-2-enoate |