Online Database of Chemicals from Around the World

N,N-Dimethylaniline sulfate
[CAS# 58888-49-6]

List of Suppliers
Tianjin Zhongxin Chem-tech Co., Ltd. China Inquire  
+86 (22) 6688-0623
sales@tjzxchem.com
Chemical manufacturer since 2007
chemBlink standard supplier since 2009
BOC Sciences USA Inquire  
+1 (631) 485-4226
info@bocsci.com
Chemical manufacturer
chemBlink standard supplier since 2010
Complete supplier list of N,N-Dimethylaniline sulfate
Identification
Classification Organic raw materials >> Amino compound >> Cycloalkylamines, aromatic monoamines, aromatic polyamines and derivatives and salts
Name N,N-Dimethylaniline sulfate
Synonyms N,N-Dimethylanilinium bisulfate; N,N-Dimethylanilinium hydrogen sulfate
Molecular Structure CAS # 58888-49-6, N,N-Dimethylaniline sulfate, N,N-Dimethylanilinium bisulfate, N,N-Dimethylanilinium hydrogen sulfate
Molecular Formula C8H11N.H2SO4
Molecular Weight 219.25
CAS Registry Number 58888-49-6
SMILES CN(C)C1=CC=CC=C1.OS(=O)(=O)O
Properties
Melting point 88-89 ºC
up Discovory and Applicatios
N,N-Dimethylaniline sulfate is an organic compound that plays a significant role in various industrial applications and chemical processes. It is the sulfate salt of N,N-dimethylaniline, a tertiary amine known for its aromatic structure and unique chemical properties. N,N-Dimethylaniline itself was first synthesized in the early 19th century, around the 1830s, during the burgeoning field of organic chemistry. Its ability to act as a precursor in dye production and as a building block for various chemical syntheses quickly established its importance in the chemical industry.

The production of N,N-dimethylaniline sulfate involves the reaction of N,N-dimethylaniline with sulfuric acid, resulting in the formation of the sulfate salt. This transformation not only enhances the solubility of the compound in water but also increases its applicability in various sectors. One of the primary uses of N,N-dimethylaniline sulfate is as a dye intermediate, particularly in the synthesis of azo dyes. These dyes are widely utilized in textiles, paper, and food industries due to their vibrant colors and excellent stability. The presence of the sulfate group improves the compound's reactivity, making it an ideal candidate for coupling reactions that yield complex dye structures.

In addition to its role in dye manufacturing, N,N-dimethylaniline sulfate finds application in the production of agrochemicals and pharmaceuticals. Its ability to serve as a reactant in the synthesis of various active ingredients allows for the development of new products with enhanced efficacy. For instance, it can be used in the production of herbicides and insecticides, which are crucial for modern agricultural practices. Furthermore, N,N-dimethylaniline sulfate is involved in the formulation of specific pharmaceutical agents, where it can act as a stabilizer or a reactant in complex organic syntheses.

Another significant application of N,N-dimethylaniline sulfate lies in its role as a catalyst or co-catalyst in organic reactions. Its properties enable it to facilitate various chemical transformations, making it valuable in synthetic organic chemistry. Researchers have explored its potential in numerous reactions, including those related to polymer chemistry, where it can help initiate or accelerate polymerization processes.

N,N-Dimethylaniline sulfate is also used in electrochemical applications. Its presence in certain electrolyte formulations can enhance conductivity, which is essential for the efficient functioning of electrochemical cells and batteries. This aspect is particularly relevant in the development of advanced energy storage systems, where optimizing electrolyte performance is crucial.

In conclusion, N,N-dimethylaniline sulfate is a versatile chemical compound with a wide range of applications across various industries, including textiles, agriculture, pharmaceuticals, and electrochemistry. Its discovery has significantly impacted the chemical industry, facilitating the development of dyes, agrochemicals, and pharmaceuticals. The ongoing exploration of its properties and potential applications continues to reveal new opportunities for this important chemical substance.
Market Analysis Reports
List of Reports Available for N,N-Dimethylaniline sulfate
Related Products
1,2-Dimethylbenzene  N,2-Dimethylaniline  2,5-Dimethylaniline  2,4-Dimethyl aniline  N,N-Dimethylaniline  2,3-Dimethylaniline  3,5-Dimethylaniline  2,6-Dimethylaniline-D6  2,4-Dimethylaniline hydrochloride  4-(N,N-Dimethyl)aniline magnesium bromide  2,4-Dimethylaniline-6-sulfonic acid  3,4-Dimethylaniline-6-sulfonic acid  Dimethylanilinium tetrakis(pentafluorophenyl)borate  2,5-Dimethylanisaldehyde  2,3-Dimethylanisole  3,5-Dimethylanisole  2,6-Dimethylanisole  2,4-Dimethylanisole  9,10-Dimethylanthracene  1,4-Dimethyl-9,10-anthracenedione