| Henan Ouber Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (371) 6532-2607 +86 18937141980 | |||
![]() |
anna.zhang@oubertec.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18937141980 | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink massive supplier since 2020 | ||||
| Name | 1-N,3-N-diphenylbenzene-1,3-diamine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C18H16N2 |
| Molecular Weight | 260.33 |
| CAS Registry Number | 5905-36-2 |
| EC Number | 611-787-0 |
| SMILES | C1=CC=C(C=C1)NC2=CC(=CC=C2)NC3=CC=CC=C3 |
| Solubility | 7.353 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.694, Calc.* |
| Melting point | 143.27 ºC |
| Boiling Point | 435.6±28.0 ºC (760 mmHg), Calc.*, 398.19 ºC |
| Flash Point | 276.9±15.8 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H317-H412 Details |
| Precautionary Statements | P261-P272-P273-P280-P302+P352-P333+P313-P363-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 1-N,3-N-diphenylbenzene-1,3-diamine |