| Mascot I.E. CO.,Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (519) 8501-0339 +86 13584504415 | |||
![]() |
info@mascotchem.com | |||
![]() |
QQ chat | |||
| Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2006 | ||||
| Classification | Organic raw materials >> Aryl compounds >> Anilines |
|---|---|
| Name | 3,4-Diphenylaniline |
| Molecular Structure | ![]() |
| Molecular Formula | C18H15N |
| Molecular Weight | 245.32 |
| CAS Registry Number | 10569-67-2 |
| SMILES | C1=CC=C(C=C1)C2=C(C=C(C=C2)N)C3=CC=CC=C3 |
| Solubility | 2.937 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.636, Calc.* |
| Melting point | 158.88 ºC |
| Boiling Point | 425.54 ºC, 387.5±21.0 ºC (760 mmHg), Calc.* |
| Flash Point | 198.1±17.4 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 3,4-Diphenylaniline |