| Territorial Sea Technology Qingdao Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 15092083467 | |||
![]() |
13675327813@163.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2021 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | 2-Methoxyphenyl trifluoromethanesulfonate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C8H7F3O4S |
| Molecular Weight | 256.20 |
| CAS Registry Number | 59099-58-0 |
| EC Number | 811-831-0 |
| SMILES | COC1=CC=CC=C1OS(=O)(=O)C(F)(F)F |
| Solubility | 31.65 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.469, Calc.* |
| Melting point | 83.60 ºC |
| Boiling Point | 303.15 ºC, 285.3±40.0 ºC (760 mmHg), Calc.* |
| Flash Point | 126.4±27.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H315-H319 Details | ||||||||||||||||
| Precautionary Statements | P264-P264+P265-P280-P302+P352-P305+P351+P338-P321-P332+P317-P337+P317-P362+P364 Details | ||||||||||||||||
| Hazard Classification | |||||||||||||||||
| |||||||||||||||||
| SDS | Available | ||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 2-Methoxyphenyl trifluoromethanesulfonate |