Online Database of Chemicals from Around the World
| Hoffman Fine Chemicals Pty Ltd | Australia | Inquire | ||
|---|---|---|---|---|
 |
+61 3-7003-5401 | |||
 |
info@hoffmanchemicals.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | 1-(4-Methylbenzoyl)pyrrolidine |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.25 |
| CAS Registry Number | 59746-40-6 |
| SMILES | CC1=CC=C(C=C1)C(=O)N2CCCC2 |
| Solubility | 729.4 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.566, Calc.* |
| Melting point | 88.42 ºC |
| Boiling Point | 315.79 ºC, 333.1±21.0 ºC (760 mmHg), Calc.* |
| Flash Point | 153.1±13.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
GHS07 Warning Details |
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P330-P362-P403+P233-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Methylbenzoyl)pyrrolidine |