| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Organic raw materials >> Heterocyclic compound >> Imidazoles |
|---|---|
| Name | 1-Methyl-2-(methylsulfonyl)-1H-benzimidazole |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.25 |
| CAS Registry Number | 61078-14-6 |
| SMILES | CN1C2=CC=CC=C2N=C1S(=O)(=O)C |
| Solubility | 1.94e+004 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.635, Calc.* |
| Melting point | 149.66 ºC |
| Boiling Point | 394.5±25.0 ºC (760 mmHg), Calc.*, 399.66 ºC |
| Flash Point | 192.4±23.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H319-H335 Details |
| Precautionary Statements | P261-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-2-(methylsulfonyl)-1H-benzimidazole |