Online Database of Chemicals from Around the World

5,6-Dimethoxybenzo[d]thiazol-2-amine
[CAS 6294-52-6]

List of Suppliers
Fenhe Chemical Co., Ltd. China
www.fenhechem.com
+86 (021) 3392-6068
julius.wei@fenhechem.com
Chemical manufacturer since 1997
chemBlink Standard supplier since 2024

Identification
ClassificationPharmaceutical intermediate >> Heterocyclic compound intermediate >> Pyrimidine compound >> Amine
Name5,6-Dimethoxybenzo[d]thiazol-2-amine
SynonymsL-Prolyl-L-leucine
Molecular Structure5,6-Dimethoxybenzo[d]thiazol-2-amine molecular structure (CAS 6294-52-6)
Molecular FormulaC9H10N2O2S
Molecular Weight210.25
CAS Registry Number6294-52-6
EC Number864-812-4
SMILESCOC1=C(C=C2C(=C1)N=C(S2)N)OC
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH302-H315-H319-H335  Details
Safety StatementsP261-P264-P264+P265-P270-P271-P280-P301+P317-P302+P352-P304+P340-P305+P351+P338-P319-P321-P330-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501  Details
Hazard Classification
up    Details
HazardClassCategory CodeHazard Statement
Specific target organ toxicity - single exposureSTOT SE3H335
Skin irritationSkin Irrit.2H315
Acute toxicityAcute Tox.4H302
Eye irritationEye Irrit.2AH319
SDSAvailable
up chemBlink Chemical Story
5,6-Dimethoxybenzo[d]thiazol-2-amine is a chemical compound that has gained attention for its unique structure and diverse applications in research and industry. This molecule features a benzo[d]thiazole ring system, with methoxy groups and an amine substituent, which collectively contribute to its distinctive chemical and biological properties.

The discovery of 5,6-Dimethoxybenzo[d]thiazol-2-amine arose from studies focused on the synthesis and properties of heterocyclic compounds. The benzo[d]thiazole ring system is known for its stability and reactivity, making it an attractive framework for various chemical modifications. The addition of methoxy groups at the 5 and 6 positions, along with the amine group at position 2, enhances the molecule's versatility and potential for different applications.

In medicinal chemistry, 5,6-Dimethoxybenzo[d]thiazol-2-amine is investigated for its potential as a pharmacological agent. The benzo[d]thiazole core is associated with various biological activities, including antimicrobial and anticancer properties. The presence of the methoxy and amine groups can influence the molecule's interaction with biological targets, potentially leading to the development of new therapeutic agents. Researchers are exploring how these modifications affect the compound’s efficacy and selectivity, aiming to discover novel drugs with enhanced therapeutic profiles.

The compound also finds applications in materials science. The unique structure of 5,6-Dimethoxybenzo[d]thiazol-2-amine makes it useful in the development of organic materials with specific properties. For instance, its ability to participate in various chemical reactions can be leveraged to create new polymers or specialty chemicals. These materials can be applied in areas such as electronics, coatings, and sensors, where the compound's distinctive chemical characteristics contribute to the performance of the final products.

Additionally, 5,6-Dimethoxybenzo[d]thiazol-2-amine serves as a valuable intermediate in organic synthesis. Its functional groups enable it to participate in reactions that form complex molecules, making it a useful tool for chemists developing new compounds. The ability to modify and incorporate this compound into larger chemical frameworks opens up possibilities for innovation in both academic and industrial research.

Overall, 5,6-Dimethoxybenzo[d]thiazol-2-amine is a compound with significant potential due to its unique structural features and reactivity. Its applications in medicinal chemistry, materials science, and organic synthesis highlight its importance in advancing research and development across various scientific disciplines.

References

2016. A High-Throughput Screening Strategy to Identify Protein-Protein Interaction Inhibitors That Block the Fanconi Anemia DNA Repair Pathway. Journal of biomolecular screening, 21(6).
DOI: 5038921
Market Analysis Reports
Related Products
4,4'-Dimethoxyb...  1-(7,8-Dimethox...  2,6-Dimethoxy-1...  2,3-Dimethoxy-1...  2,5-Dimethoxybe...  2,6-Dimethoxy-1...  2,6-Dimethoxy-1...  6,15-Dimethoxyb...  4,7-Dimethoxy-2...  4,5-Dimethoxy-1...  4,6-Dimethoxy-1...  4,7-Dimethoxy-1...  2,6-Dimethoxy-1...  4,7-Dimethoxy-1...  2,6-Dimethoxy-1...  5,6-Dimethoxybe...  2,5-Dimethoxy-1...  5,6-Dimethoxy-1...  4,7-Dimethoxy-1...  4,6-Dimethoxy-1...