| Nanjing Finetech Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (25) 5207-8417 +86 17714198479 | |||
![]() |
sales@fine-chemtech.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2007 | ||||
| chemBlink standard supplier since 2007 | ||||
| Name | 1,7,8-Trifluoronaphthalen-2-ol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H5F3O |
| Molecular Weight | 198.14 |
| CAS Registry Number | 676545-61-2 |
| EC Number | 614-097-8 |
| SMILES | C1=CC(=C(C2=C1C=CC(=C2F)F)F)O |
| Solubility | 263.5 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.599, Calc.* |
| Melting point | 68.65 ºC |
| Boiling Point | 271.79 ºC, 290.7±35.0 ºC (760 mmHg), Calc.* |
| Flash Point | 126.0±20.4 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 1,7,8-Trifluoronaphthalen-2-ol |