| Alder Research Chemicals Private Limited | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (900) 301-4798 | |||
![]() |
sales@alderchemicals.com | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink standard supplier since 2020 | ||||
| Name | 2,4,4,4-Tetrachlorobutyryl chloride |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C4H3Cl5O |
| Molecular Weight | 244.33 |
| CAS Registry Number | 68121-36-8 |
| EC Number | 268-527-0 |
| SMILES | C(C(C(=O)Cl)Cl)C(Cl)(Cl)Cl |
| Solubility | 454.8 mg/L (25 ºC water) |
|---|---|
| Density | 1.6±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.513, Calc.* |
| Melting point | 31.76 ºC |
| Boiling Point | 220.16 ºC, 263.2±35.0 ºC (760 mmHg), Calc.* |
| Flash Point | 108.7±26.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 2,4,4,4-Tetrachlorobutyryl chloride |