| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Doxofylline Impurity 10 |
|---|---|
| Synonyms | ethyl (1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydro-7H-purin-7-yl)acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14N4O4 |
| Molecular Weight | 266.25 |
| CAS Registry Number | 7029-96-1 |
| SMILES | CCOC(=O)CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
| Solubility | 649.1 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.635, Calc.* |
| Melting point | 208.78 ºC |
| Boiling Point | 491.83 ºC, 478.0±51.0 ºC (760 mmHg), Calc.* |
| Flash Point | 242.9±30.4 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302+H312+H332-H315-H319 Details |
| Precautionary Statements | P261-P271-P280-P302+P352-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Doxofylline Impurity 10 |