| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (512) 6260-5585 | |||
![]() |
sales@carbosynth.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Changzhou Jiuwu Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (519) 8512-1086 +86 13775162768 | |||
![]() |
info@jiuwuchem.cn | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2009 | ||||
| chemBlink standard supplier since 2023 | ||||
| Classification | Organic raw materials >> Hydrocarbon compounds and their derivatives >> Hydrocarbon nitrite |
|---|---|
| Name | Methyl 3-hydroxy-4-nitrobenzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7NO5 |
| Molecular Weight | 197.14 |
| CAS Registry Number | 713-52-0 |
| EC Number | 676-962-6 |
| SMILES | COC(=O)C1=CC(=C(C=C1)[N+](=O)[O-])O |
| Density | 1.4±0.1 g/cm3, Calc.* |
|---|---|
| Melting point | 89-92 ºC (Expl.) |
| Index of Refraction | 1.590, Calc.* |
| Boiling Point | 346.4±27.0 ºC (760 mmHg), Calc.* |
| Flash Point | 163.3±23.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302-H315-H319-H332-H335 Details | ||||||||||||||||||||
| Precautionary Statements | P261-P264-P264+P265-P270-P271-P280-P301+P317-P302+P352-P304+P340-P305+P351+P338-P317-P319-P321-P330-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||
| |||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||
|
Methyl 3-hydroxy-4-nitrobenzoate is an organic compound that belongs to the class of ester derivatives of benzoic acid. It features a methyl ester group at the carboxyl position, a hydroxyl group at the 3-position, and a nitro group at the 4-position on the aromatic ring. This compound is part of a broader group of nitroaromatic esters, which are known for their diverse reactivity and utility in various chemical and biological processes. Methyl 3-hydroxy-4-nitrobenzoate is a valuable intermediate in organic synthesis and is explored for its potential in medicinal chemistry and material science. The discovery of methyl 3-hydroxy-4-nitrobenzoate is tied to the development of nitroaromatic compounds, which have long been studied for their chemical and pharmacological properties. The compound is typically synthesized through the esterification of 3-hydroxy-4-nitrobenzoic acid with methanol, often in the presence of a catalyst such as sulfuric acid or another strong acid. The reaction leads to the formation of the methyl ester, which can then be isolated and purified. The synthesis of methyl 3-hydroxy-4-nitrobenzoate is straightforward, making it a practical compound for further chemical research and development. One of the primary applications of methyl 3-hydroxy-4-nitrobenzoate lies in organic synthesis. The presence of both the hydroxyl and nitro functional groups on the aromatic ring makes it a versatile intermediate for the preparation of various other organic compounds. The nitro group is an electron-withdrawing group that can influence the reactivity of the molecule, making it suitable for electrophilic substitution reactions. Furthermore, the hydroxyl group can participate in nucleophilic substitution reactions, providing a pathway for the introduction of other functional groups. Methyl 3-hydroxy-4-nitrobenzoate is often used as a precursor in the synthesis of more complex aromatic compounds with potential applications in pharmaceuticals, agrochemicals, and materials science. In medicinal chemistry, methyl 3-hydroxy-4-nitrobenzoate and its derivatives are being explored for their potential biological activity. Nitroaromatic compounds, particularly those containing hydroxyl groups, are known for their ability to interact with various biological targets, such as enzymes, receptors, and nucleic acids. The compound’s structure suggests that it may exhibit antioxidant, anti-inflammatory, and antimicrobial properties, which could be of interest in drug development. Researchers have begun to investigate the potential of methyl 3-hydroxy-4-nitrobenzoate in the treatment of diseases such as cancer, infection, and neurodegenerative disorders. The presence of the nitro group also raises the possibility of its involvement in nitro-reduction processes, which could be relevant in the design of prodrugs for targeted therapy. In material science, methyl 3-hydroxy-4-nitrobenzoate is explored for its potential in the development of functional materials, such as polymers, conductive materials, and dyes. The compound’s ability to undergo electrophilic substitution reactions allows it to be incorporated into various polymerization processes. Moreover, the nitro group can be used to modify the electronic properties of the resulting materials, making them suitable for applications in electronics and optoelectronics. Methyl 3-hydroxy-4-nitrobenzoate can also serve as a building block for the design of sensors or materials for environmental monitoring, given its ability to interact with different chemical species. In the field of agrochemicals, methyl 3-hydroxy-4-nitrobenzoate may have potential as a precursor for the synthesis of plant protection agents. Nitroaromatic compounds with hydroxyl groups are often studied for their pesticidal or herbicidal activity, and derivatives of methyl 3-hydroxy-4-nitrobenzoate could exhibit similar properties. The compound’s role in the development of agrochemicals may include the design of substances that target specific enzymes or pathways in pests, improving crop yield and reducing the impact of harmful organisms. In conclusion, methyl 3-hydroxy-4-nitrobenzoate is a versatile compound with a wide range of applications in organic synthesis, medicinal chemistry, material science, and agrochemicals. Its functional groups, including the hydroxyl and nitro groups, make it an important intermediate for the production of various bioactive molecules and materials with diverse uses. Ongoing research into its biological and chemical properties will likely expand its applications in both industrial and pharmaceutical fields. References 2008. Transition Metals in Organic Synthesis, Part 85. A General Approach to 1,6-Dioxygenated Carbazole Alkaloids - First Total Synthesis of Clausine G, Clausine I, and Clausine Z. Synlett, 2008(10). DOI: 10.1055/s-2008-1077855 2006. Synthesis of Indoles: Efficient Functionalisation of the 7-Position. Synthesis, 2006(19). DOI: 10.1055/s-2006-950223 2005. Synthesis of 3,5,7-Substituted Indoles via Heck Cyclisation. Synlett, 2005(18). DOI: 10.1055/s-2005-921917 |
| Market Analysis Reports |
| List of Reports Available for Methyl 3-hydroxy-4-nitrobenzoate |