| Sichuan Taienkang Pharmaceutical Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.taienkangpharma.com | |||
![]() | +86 15102825326 | |||
![]() | sales@taienkangpharma.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink Standard supplier since 2024 | ||||
| Classification | Pharmaceutical intermediate >> Heterocyclic compound intermediate >> Pyrimidine compound >> Alcohol |
|---|---|
| Name | 6-(2-Amino-4-methoxyphenyl)-5,6,7,8-tetrahydronaphthalen-2-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 |
| CAS Registry Number | 722520-36-7 |
| SMILES | COC1=CC(=C(C=C1)C2CCC3=C(C2)C=CC(=C3)O)N |
|
6-(2-Amino-4-methoxyphenyl)-5,6,7,8-tetrahydronaphthalen-2-ol is a chemical compound with potential applications in medicinal chemistry due to its structural features, which combine a tetrahydronaphthalene core with an amino and methoxyphenyl group. This structure imparts biological activity and makes the compound an interesting target for drug discovery, particularly in the areas of neurochemistry and oncology. The compound features a naphthalene ring system, which is known for its stability and the ability to interact with a variety of biological targets. The hydroxyl group at the 2-position of the naphthalene ring provides additional functional reactivity, making it a useful precursor in the synthesis of more complex molecules. The amino group at the 2-position of the phenyl ring and the methoxy group at the 4-position contribute to the molecule’s electronic properties, enhancing its potential for receptor binding and enzyme interaction. Synthetically, 6-(2-Amino-4-methoxyphenyl)-5,6,7,8-tetrahydronaphthalen-2-ol can be prepared through a series of synthetic steps involving the functionalization of a naphthalene derivative. The introduction of the amino and methoxy groups onto the phenyl ring is typically achieved via electrophilic aromatic substitution reactions, followed by the reduction of a suitable precursor to obtain the tetrahydronaphthalene scaffold. This method of synthesis provides good control over the placement of functional groups, which is essential for modulating the biological activity of the compound. In terms of its applications, 6-(2-Amino-4-methoxyphenyl)-5,6,7,8-tetrahydronaphthalen-2-ol holds promise as a candidate for drug development, particularly for neurological diseases. The presence of both amino and methoxy groups suggests it may interact with neurotransmitter systems or serve as a scaffold for the development of receptor modulators. Additionally, the compound may have anti-inflammatory or anticancer properties, making it a potential candidate for the treatment of conditions involving oxidative stress or cell proliferation. While studies on this specific compound are still limited, its structural features suggest that it could interact with biological pathways relevant to various therapeutic areas. Further research, including in vitro and in vivo studies, will be necessary to explore its pharmacological profile, including its potency, selectivity, and potential side effects. Such research could lead to the development of new therapeutic agents based on this compound's molecular architecture. |
| Market Analysis Reports |