| Dongsheng Chiral (shanghai) Pharmaceuticals Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (0512) 6319-7098 | |||
![]() |
3755454181@qq.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: wxid_autjyahp6yfm22 | |||
| Chemical manufacturer since 2014 | ||||
| chemBlink standard supplier since 2023 | ||||
| Classification | Organic raw materials >> Ketone compound |
|---|---|
| Name | 1-(3-Fluoro-4-nitrophenyl)ethanone |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6FNO3 |
| Molecular Weight | 183.14 |
| CAS Registry Number | 72802-25-6 |
| EC Number | 892-834-4 |
| SMILES | CC(=O)C1=CC(=C(C=C1)[N+](=O)[O-])F |
| Solubility | 777.7 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.537, Calc.* |
| Melting point | 72.58 ºC |
| Boiling Point | 273.43 ºC, 293.6±20.0 ºC (760 mmHg), Calc.* |
| Flash Point | 131.4±21.8 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P261-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 1-(3-Fluoro-4-nitrophenyl)ethanone |