| Mascot I.E. CO.,Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (519) 8501-0339 +86 13584504415 | |||
![]() |
info@mascotchem.com | |||
![]() |
QQ chat | |||
| Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2006 | ||||
| Classification | Organic raw materials >> Heterocyclic compound >> Carbazoles |
|---|---|
| Name | 3,6-Dibromo-9-(4-bromophenyl)-9H-carbazole |
| Molecular Formula | C18H10Br3N |
| Molecular Weight | 479.99 |
| CAS Registry Number | 73087-83-9 |
| EC Number | 808-076-4 |
| SMILES | C1=CC(=CC=C1N2C3=C(C=C(C=C3)Br)C4=C2C=CC(=C4)Br)Br |
| Solubility | 2.124e-005 mg/L (25 ºC water) |
|---|---|
| Density | 1.9±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.725, Calc.* |
| Melting point | 213.67 ºC |
| Boiling Point | 502.29 ºC, 538.2±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 279.3±30.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302-H315-H319-H332-H335 Details | ||||||||||||||||
| Precautionary Statements | P261-P280-P305+P351+P338 Details | ||||||||||||||||
| Hazard Classification | |||||||||||||||||
| |||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 3,6-Dibromo-9-(4-bromophenyl)-9H-carbazole |