| Hoffman Fine Chemicals Pty Ltd | Australia | Inquire | ||
|---|---|---|---|---|
![]() |
+61 3-7003-5401 | |||
![]() |
info@hoffmanchemicals.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2023 | ||||
| Classification | Organic raw materials >> Organic fluorine compound >> Fluorine red series |
|---|---|
| Name | 5-Fluoro-7-methyl isatin |
| Molecular Structure | ![]() |
| Molecular Formula | C9H6FNO2 |
| Molecular Weight | 179.15 |
| CAS Registry Number | 749240-57-1 |
| EC Number | 963-361-1 |
| SMILES | CC1=CC(=CC2=C1NC(=O)C2=O)F |
| Solubility | 5249 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.574, Calc.* |
| Melting point | 139.40 ºC |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Classification | |||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| |||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 5-Fluoro-7-methyl isatin |