| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Classification | Chemical reagent >> Organic reagent >> Sulfone, sulfoxide compound |
|---|---|
| Name | Promethazine sulfoxide |
| Synonyms | N,N-dimethyl-1-(5-oxophenothiazin-10-yl)propan-2-amine |
| Molecular Structure | ![]() |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.42 |
| CAS Registry Number | 7640-51-9 |
| EC Number | 642-098-3 |
| SMILES | CC(CN1C2=CC=CC=C2S(=O)C3=CC=CC=C31)N(C)C |
| Solubility | 112.6 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.678, Calc.* |
| Melting point | 167.99 ºC |
| Boiling Point | 423.74 ºC, 461.6±34.0 ºC (760 mmHg), Calc.* |
| Flash Point | 233.0±25.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Promethazine sulfoxide |