|
CAS: 77239-98-6 Product: Bromadol No suppilers available. |
| Name | Bromadol |
|---|---|
| Synonyms | 4-(4-bromophenyl)-4-(dimethylamino)-1-(2-phenylethyl)cyclohexan-1-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C22H28BrNO |
| Molecular Weight | 402.37 |
| CAS Registry Number | 77239-98-6 |
| SMILES | CN(C)C1(CCC(CC1)(CCC2=CC=CC=C2)O)C3=CC=C(C=C3)Br |
| Solubility | 0.2346 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.614, Calc.* |
| Melting point | 187.23 ºC |
| Boiling Point | 452.51 ºC, 488.8±45.0 ºC (760 mmHg), Calc.* |
| Flash Point | 249.4±28.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Bromadol |