| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | C11-14-iso-Alcohols,C13-rich, ethoxylated |
|---|---|
| Synonyms | Polyoxyethylene (10) tridecyl ether; C13E10; 47-Methyl-3,6,9,12,15,18,21,24,27,30,33,36-dodecaoxaoctatetracontan-1-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C13H27(OCH2CH2)nOH |
| CAS Registry Number | 78330-21-9 |
| EC Number | 934-084-3 |
| SMILES | CC(C)CCCCCCCCCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO |
| Density | 0.980 g/cm3, 1.0±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.461, Calc.* |
| Boiling Point | >150 ºC (1,013 hPa), 707.5±55.0 ºC (760 mmHg), Calc.* |
| Flash Point | >110.00 ºC (closed cup), 381.7±31.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H318 Details | ||||||||||||||||||||||||||||
| Precautionary Statements | P280-P305+P351+P338-P310 Details | ||||||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for C11-14-iso-Alcohols,C13-rich, ethoxylated |