Online Database of Chemicals from Around the World
| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (551) 6288-8437 +86 18096409024 | |||
 |
info@purerechem.com | |||
 |
Skype Chat | |||
 |
QQ chat | |||
 |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Salbutamol Impurity 6 |
|---|---|
| Synonyms | 4-(2-(tert-Butylamino)-1-methoxyethyl)-2-(methoxymethyl)phenol |
| Molecular Structure |  |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.36 |
| CAS Registry Number | 870076-73-6 |
| SMILES | CC(C)(C)NCC(C1=CC(=C(C=C1)O)COC)OC |
| Solubility | 1.922e+004 mg/L (25 ºC water) |
|---|---|
| Density | 1.0±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.511, Calc.* |
| Melting point | 124.54 ºC |
| Boiling Point | 352.97 ºC, 354.1±37.0 ºC (760 mmHg), Calc.* |
| Flash Point | 167.9±26.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Salbutamol Impurity 6 |