| Shandong Dinghao Biotechnology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (0531) 5856-5868 | |||
![]() |
lily.zhou@sddhpharm.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2018 | ||||
| chemBlink standard supplier since 2022 | ||||
| Name | Methyl {8-fluoro-3-[2-methoxy-5-(trifluoromethyl)phenyl]-2-oxo-1,2,3,4-tetrahydro-4-quinazolinyl}acetate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C19H16F4N2O4 |
| Molecular Weight | 412.33 |
| CAS Registry Number | 917389-21-0 |
| EC Number | 801-725-2 |
| SMILES | COC1=C(C=C(C=C1)C(F)(F)F)N2C(C3=C(C(=CC=C3)F)NC2=O)CC(=O)OC |
| Solubility | 3.13 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.523, Calc.* |
| Melting point | 204.99 ºC |
| Boiling Point | 483.71 ºC, 505.1±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 259.3±30.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302-H315-H319-H335 Details | ||||||||||||
| Precautionary Statements | P261 Details | ||||||||||||
| Hazard Classification | |||||||||||||
| |||||||||||||
| SDS | Available | ||||||||||||
| Market Analysis Reports |
| List of Reports Available for Methyl {8-fluoro-3-[2-methoxy-5-(trifluoromethyl)phenyl]-2-oxo-1,2,3,4-tetrahydro-4-quinazolinyl}acetate |