| Shanghai Landtoller Chemtech Co.,Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
021-52960915 | |||
![]() |
maryma@landtoller.com | |||
| Chemical distributor since 2019 | ||||
| chemBlink standard supplier since 2024 | ||||
| Name | methyl (2E)-3-{3-fluoro-2-[({[2-methoxy-5-(trifluoromethyl)phenyl]amino}carbonyl)amino]phenyl}acrylate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C19H16F4N2O4 |
| Molecular Weight | 412.33 |
| CAS Registry Number | 917389-26-5 |
| SMILES | COC1=C(C=C(C=C1)C(F)(F)F)NC(=O)NC2=C(C=CC=C2F)/C=C/C(=O)OC |
| Density | 1.4±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.592, Calc.* |
| Boiling Point | 410.4±45.0 ºC (760 mmHg), Calc.* |
| Flash Point | 202.0±28.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P321-P330-P337-P362+P364-P403+P233-P405-P501 Details |
| Market Analysis Reports |
| List of Reports Available for methyl (2E)-3-{3-fluoro-2-[({[2-methoxy-5-(trifluoromethyl)phenyl]amino}carbonyl)amino]phenyl}acrylate |