Online Database of Chemicals from Around the World
| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (551) 6288-8437 +86 18096409024 | |||
 |
info@purerechem.com | |||
 |
Skype Chat | |||
 |
QQ chat | |||
 |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Ciprofloxacin EP Impurity B |
|---|---|
| Synonyms | 1-Cyclopropyl-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid |
| Molecular Structure |  |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.35 |
| CAS Registry Number | 93107-11-0 |
| EC Number | 641-521-9 |
| SMILES | C1CC1N2C=C(C(=O)C3=C2C=C(C=C3)N4CCNCC4)C(=O)O |
| Solubility | 3.781e+004 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.671, Calc.* |
| Melting point | 317.06 ºC |
| Boiling Point | 569.22 ºC, 568.5±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 297.6±30.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Ciprofloxacin EP Impurity B |