| Shanghai Worldyang Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13651600618 +86 (21) 5679-5779 | |||
![]() |
sales7777@worldyachem.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 13651600618 | |||
![]() |
WhatsApp: +86 13651600618 | |||
| Chemical manufacturer since 2012 | ||||
| chemBlink premium supplier since 2023 | ||||
| Classification | Chemical reagent >> Organic reagent >> Sulfonate / sulfinate |
|---|---|
| Name | 3-[(Ethoxythioxomethyl)thio]-1-propanesulfonic acid potassium salt |
| Synonyms | Potassium 3-ethoxycarbothioylsulfanylpropane-1-sulfonate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12O4S3.K |
| Molecular Weight | 283.45 |
| CAS Registry Number | 93841-14-6 |
| EC Number | 298-984-1 |
| SMILES | CCOC(=S)SCCCS(=O)(=O)[O-].[K+] |
| Hazard Symbols |
| ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H301+H311-H301-H311-H315-H319 Details | ||||||||||||||||||||||||||||||||||||
| Precautionary Statements | P262-P264-P264+P265-P270-P280-P301+P316-P302+P352-P305+P351+P338-P316-P321-P330-P332+P317-P337+P317-P361+P364-P362+P364-P405-P501 Details | ||||||||||||||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||
|
3-[(Ethoxythioxomethyl)thio]-1-propanesulfonic acid potassium salt is a sulfonic acid derivative that has gained attention in various fields due to its unique chemical properties and potential applications. The discovery of this compound is rooted in the ongoing quest for effective surfactants and functional additives that can enhance the performance of chemical formulations. Its distinctive structure, which features a thioether and a sulfonate group, contributes to its solubility and surface activity, making it valuable in numerous industrial applications. The synthesis of 3-[(ethoxythioxomethyl)thio]-1-propanesulfonic acid potassium salt involves a multi-step reaction process that begins with the preparation of the corresponding thio compound. This is typically followed by sulfonation, where the thioether is reacted with a sulfonating agent to introduce the sulfonic acid functional group. The final step involves neutralization with potassium hydroxide, resulting in the formation of the potassium salt. The product is usually obtained as a white to off-white crystalline powder, soluble in water and various organic solvents. One of the primary applications of 3-[(ethoxythioxomethyl)thio]-1-propanesulfonic acid potassium salt is in the formulation of surfactants. Its ability to reduce surface tension and improve wetting properties makes it an effective additive in cleaning products and detergents. In household and industrial formulations, this compound enhances the cleaning efficiency by facilitating the removal of oils, dirt, and grease, making it a crucial ingredient for achieving optimal cleaning results. Additionally, this potassium salt has been explored for its role as an emulsifier in cosmetic and personal care products. Its emulsifying properties enable the stable mixing of oil and water phases, which is essential for the formulation of creams, lotions, and shampoos. The presence of the ethoxythioxomethyl group enhances the stability and texture of these formulations, contributing to improved user experience and product effectiveness. In the agricultural sector, 3-[(ethoxythioxomethyl)thio]-1-propanesulfonic acid potassium salt serves as a wetting agent in pesticide formulations. By improving the spreadability and adhesion of active ingredients on plant surfaces, this compound enhances the effectiveness of agrochemical products. Its surfactant properties are particularly beneficial in ensuring that pesticides can penetrate plant tissues effectively, leading to better crop protection and yield. Moreover, the unique chemical structure of this compound has made it a candidate for use in biochemical applications, particularly in protein stabilization and solubilization. By interacting with proteins and other biomolecules, 3-[(ethoxythioxomethyl)thio]-1-propanesulfonic acid potassium salt can help maintain structural integrity and enhance stability, which is valuable in various biotechnological and pharmaceutical processes. Overall, the discovery and application of 3-[(ethoxythioxomethyl)thio]-1-propanesulfonic acid potassium salt highlight its versatility as a functional additive across multiple industries, including cleaning, cosmetics, agriculture, and biotechnology. Its unique properties continue to support advancements in formulation science and product development. |
| Market Analysis Reports |
| List of Reports Available for 3-[(Ethoxythioxomethyl)thio]-1-propanesulfonic acid potassium salt |