| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | API >> Inhibitor drug |
|---|---|
| Name | Sephin1 |
| Synonyms | IFB-088;Icerguastat;2-[(E)-(2-chlorophenyl)methylideneamino]guanidine |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9ClN4 |
| Molecular Weight | 196.64 |
| CAS Registry Number | 951441-04-6 |
| SMILES | C1=CC=C(C(=C1)/C=N/N=C(N)N)Cl |
| Density | 1.9±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.727, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H301 Details |
| Precautionary Statements | P264-P270-P301+P310-P405-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Sephin1 |