|
CAS#: 10302-94-0 Product: Diethyl (Z)-2-Chlorobut-2-Enedioate No suppilers available for the product. |
| Name | Diethyl (Z)-2-Chlorobut-2-Enedioate |
|---|---|
| Synonyms | Diethyl 2-Chlorobut-2-Enedioate; (Z)-2-Chlorobut-2-Enedioic Acid Diethyl Ester; 2-Chlorobut-2-Enedioic Acid Diethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C8H11ClO4 |
| Molecular Weight | 206.63 |
| CAS Registry Number | 10302-94-0 |
| SMILES | C(OC(/C(=C/C(=O)OCC)Cl)=O)C |
| InChI | 1S/C8H11ClO4/c1-3-12-7(10)5-6(9)8(11)13-4-2/h5H,3-4H2,1-2H3/b6-5- |
| InChIKey | VOEQTGMCAHZUNJ-WAYWQWQTSA-N |
| Density | 1.199g/cm3 (Cal.) |
|---|---|
| Boiling point | 256.515°C at 760 mmHg (Cal.) |
| Flash point | 101.973°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl (Z)-2-Chlorobut-2-Enedioate |