|
CAS#: 107369-97-1 Product: 2,4-Dimethyl-8,9-cyclopentene-3H-(1,4)diazepine(2,3-g)indole No suppilers available for the product. |
| Name | 2,4-Dimethyl-8,9-cyclopentene-3H-(1,4)diazepine(2,3-g)indole |
|---|---|
| Synonyms | 2,4-Dimethyl-8,9-Cyclopentene-3H-(1,4)Diazepine(2,3-G)Indole; 3H-Cyclopenta(4,5)Pyrrolo(2,3-G)-1,5-Benzodiazepine, 8,9,10,11-Tetrahydro-2,4-Dimethyl-; 8,9,10,11-Tetrahydro-2,4-Dimethyl-3H-Cyclopenta(4,5)Pyrrolo(2,3-G)-1,5-Benzodiazepine |
| Molecular Structure | ![]() |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 |
| CAS Registry Number | 107369-97-1 |
| SMILES | C2=C3C(=C1N=C(CC(=NC1=C2)C)C)[NH]C4=C3CCC4 |
| InChI | 1S/C16H17N3/c1-9-8-10(2)18-16-14(17-9)7-6-12-11-4-3-5-13(11)19-15(12)16/h6-7,19H,3-5,8H2,1-2H3 |
| InChIKey | YLVCTPIVBLCQFI-UHFFFAOYSA-N |
| Density | 1.333g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.762°C at 760 mmHg (Cal.) |
| Flash point | 220.365°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dimethyl-8,9-cyclopentene-3H-(1,4)diazepine(2,3-g)indole |