|
CAS#: 113041-34-2 Product: Methyl methacrylate, butyl methacrylate, methacrylic acid polymer No suppilers available for the product. |
| Name | Methyl methacrylate, butyl methacrylate, methacrylic acid polymer |
|---|---|
| Synonyms | 2-Methylprop-2-Enoic Acid; 2-Methylprop-2-Enoic Acid Butyl Ester; 2-Methylprop-2-Enoic Acid Methyl Ester; Methacrylic Acid; 2-Methylacrylic Acid Butyl Ester; 2-Methylacrylic Acid Methyl Ester |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.40 |
| CAS Registry Number | 113041-34-2 (28262-63-7) |
| SMILES | C(OC(=O)C(=C)C)CCC.CC(C(OC)=O)=C.CC(C(=O)O)=C |
| InChI | 1S/C8H14O2.C5H8O2.C4H6O2/c1-4-5-6-10-8(9)7(2)3;1-4(2)5(6)7-3;1-3(2)4(5)6/h2,4-6H2,1,3H3;1H2,2-3H3;1H2,2H3,(H,5,6) |
| InChIKey | AFWQKFIHPQKBTK-UHFFFAOYSA-N |
| Boiling point | 160°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 50.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl methacrylate, butyl methacrylate, methacrylic acid polymer |