|
CAS#: 114435-26-6 Product: 5-Chloromaleylacetic Acid No suppilers available for the product. |
| Name | 5-Chloromaleylacetic Acid |
|---|---|
| Synonyms | (Z)-5-Chloro-4-Oxo-Hex-2-Enedioic Acid; (Z)-5-Chloro-4-Keto-Hex-2-Enedioic Acid; 2-Hexenedioic Acid,5-Chloro-4-Oxo-, (Z)- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H5ClO5 |
| Molecular Weight | 192.56 |
| CAS Registry Number | 114435-26-6 |
| SMILES | O=C(C(Cl)C(=O)O)\C=C/C(=O)O |
| InChI | 1S/C6H5ClO5/c7-5(6(11)12)3(8)1-2-4(9)10/h1-2,5H,(H,9,10)(H,11,12)/b2-1- |
| InChIKey | SCSZJXOTAAUHEL-UPHRSURJSA-N |
| Density | 1.614g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.772°C at 760 mmHg (Cal.) |
| Flash point | 197.994°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Chloromaleylacetic Acid |