|
CAS#: 116200-79-4 Product: Actinoplanone F No suppilers available for the product. |
| Name | Actinoplanone F |
|---|---|
| Synonyms | Actinoplanone F |
| Molecular Structure | ![]() |
| Molecular Formula | C32H29ClN2O11 |
| Molecular Weight | 653.04 |
| CAS Registry Number | 116200-79-4 |
| SMILES | COC7C1=C(OC4=C(C1=O)C(=O)C5=C2C(=CC3=C(C2=O)C(=O)N(NC(/C)=C(O)/C)C(=C3Cl)C)CC6OCOC4=C56)C(OC)C(O)C7 |
| InChI | 1S/C32H29ClN2O11/c1-10(12(3)36)34-35-11(2)24(33)14-6-13-7-17-20-22(18(13)25(38)19(14)32(35)41)27(40)23-26(39)21-16(42-4)8-15(37)28(43-5)30(21)46-31(23)29(20)45-9-44-17/h6,15-17,28,34,36-37H,7-9H2,1-5H3/b12-10- |
| InChIKey | AHUILBBVEGTTTO-BENRWUELSA-N |
| Density | 1.621g/cm3 (Cal.) |
|---|---|
| Boiling point | 846.51°C at 760 mmHg (Cal.) |
| Flash point | 465.753°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Actinoplanone F |